C21H32N4O3 — CID 119352167
6-[(1-tert-butyl-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]hexanoic acid (PubChem CID 119352167) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 6-[(1-tert-butyl-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(1-tert-butyl-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 119352167 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 6-[(1-tert-butyl-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]hexanoic acid |
| SMILES | Cc1nn(C(C)(C)C)c2nc(C(C)C)cc(C(=O)NCCCCCC(=O)O)c12 |
| InChI | InChI=1S/C21H32N4O3/c1-13(2)16-12-15(20(28)22-11-9-7-8-10-17(26)27)18-14(3)24-25(19(18)23-16)21(4,5)6/h12-13H,7-11H2,1-6H3,(H,22,28)(H,26,27) |
| InChIKey | VMQUJDWRDNGCMR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|