C17H19NO3 — CID 119352727
4-(2-naphthalen-2-ylpropanoylamino)butanoic acid (PubChem CID 119352727) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-(2-naphthalen-2-ylpropanoylamino)butanoic acid.
| Compound Name | 4-(2-naphthalen-2-ylpropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 119352727 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 4-(2-naphthalen-2-ylpropanoylamino)butanoic acid |
| SMILES | CC(C(=O)NCCCC(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H19NO3/c1-12(17(21)18-10-4-7-16(19)20)14-9-8-13-5-2-3-6-15(13)11-14/h2-3,5-6,8-9,11-12H,4,7,10H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | FGODDIPCVFMMIR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|