C17H18N4O3 — CID 119353448
4-[[(2-pyrrolidin-1-ylpyrimidine-4-carbonyl)amino]methyl]benzoic acid (PubChem CID 119353448) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-[[(2-pyrrolidin-1-ylpyrimidine-4-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(2-pyrrolidin-1-ylpyrimidine-4-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 119353448 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-[[(2-pyrrolidin-1-ylpyrimidine-4-carbonyl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2ccnc(N3CCCC3)n2)cc1 |
| InChI | InChI=1S/C17H18N4O3/c22-15(19-11-12-3-5-13(6-4-12)16(23)24)14-7-8-18-17(20-14)21-9-1-2-10-21/h3-8H,1-2,9-11H2,(H,19,22)(H,23,24) |
| InChIKey | STSOWHAADVUBLP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |