C16H23N3O6S — CID 119353533
4-[[3-[[2-oxo-2-(propan-2-ylamino)ethyl]sulfamoyl]propanoylamino]methyl]benzoic acid (PubChem CID 119353533) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-[[3-[[2-oxo-2-(propan-2-ylamino)ethyl]sulfamoyl]propanoylamino]methyl]benzoic acid.
| Compound Name | 4-[[3-[[2-oxo-2-(propan-2-ylamino)ethyl]sulfamoyl]propanoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 119353533 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-[[3-[[2-oxo-2-(propan-2-ylamino)ethyl]sulfamoyl]propanoylamino]methyl]benzoic acid |
| SMILES | CC(C)NC(=O)CNS(=O)(=O)CCC(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H23N3O6S/c1-11(2)19-15(21)10-18-26(24,25)8-7-14(20)17-9-12-3-5-13(6-4-12)16(22)23/h3-6,11,18H,7-10H2,1-2H3,(H,17,20)(H,19,21)(H,22,23) |
| InChIKey | WBXYZUGUMJZNNW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |