C13H15BrN2O4S — CID 119353631
1-[2-[(5-bromothiophene-2-carbonyl)-methylamino]acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 119353631) has the molecular formula C13H15BrN2O4S and a molecular weight of 375.24 g/mol. Its IUPAC name is 1-[2-[(5-bromothiophene-2-carbonyl)-methylamino]acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[(5-bromothiophene-2-carbonyl)-methylamino]acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119353631 |
| Molecular Formula | C13H15BrN2O4S |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 1-[2-[(5-bromothiophene-2-carbonyl)-methylamino]acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | CN(CC(=O)N1CCC(C(=O)O)C1)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H15BrN2O4S/c1-15(12(18)9-2-3-10(14)21-9)7-11(17)16-5-4-8(6-16)13(19)20/h2-3,8H,4-7H2,1H3,(H,19,20) |
| InChIKey | JKAIMJNCERMLGG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |