1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid

C13H13Cl2NO4 — CID 119354980

IUPAC1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C(=O)COc2c(Cl)cccc2Cl)C1
InChIInChI=1S/C13H13Cl2NO4/c14-9-2-1-3-10(15)12(9)20-7-11(17)16-5-4-8(6-16)13(18)19/h1-3,8H,4-7H2,(H,18,19)
InChIKeyBLXUGZMNMPEIRL-UHFFFAOYSA-N
MW318.16 g/mol
LogP2.31
Rot. Bonds4

About 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid

1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 119354980) has the molecular formula C13H13Cl2NO4 and a molecular weight of 318.16 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid
PubChem CID119354980
Molecular FormulaC13H13Cl2NO4
Molecular Weight318.16 g/mol
Exact Mass317.02
IUPAC Name1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C(=O)COc2c(Cl)cccc2Cl)C1
InChIInChI=1S/C13H13Cl2NO4/c14-9-2-1-3-10(15)12(9)20-7-11(17)16-5-4-8(6-16)13(18)19/h1-3,8H,4-7H2,(H,18,19)
InChIKeyBLXUGZMNMPEIRL-UHFFFAOYSA-N
XLogP2.31
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.16
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid (CID 119354980) is 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid is O=C(O)C1CCN(C(=O)COc2c(Cl)cccc2Cl)C1.
What is the InChIKey of 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid?
The InChIKey is BLXUGZMNMPEIRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2NO4/c14-9-2-1-3-10(15)12(9)20-7-11(17)16-5-4-8(6-16)13(18)19/h1-3,8H,4-7H2,(H,18,19).
What are the key properties of 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid?
1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid has a molecular weight of 318.16 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,6-dichlorophenoxy)acetyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 119354980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).