C15H17F3N2O5S — CID 119355103
1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 119355103) has the molecular formula C15H17F3N2O5S and a molecular weight of 394.37 g/mol. Its IUPAC name is 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119355103 |
| Molecular Formula | C15H17F3N2O5S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC(NS(=O)(=O)c1ccccc1C(F)(F)F)C(=O)N1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C15H17F3N2O5S/c1-9(13(21)20-7-6-10(8-20)14(22)23)19-26(24,25)12-5-3-2-4-11(12)15(16,17)18/h2-5,9-10,19H,6-8H2,1H3,(H,22,23) |
| InChIKey | AJNXAIOVTCLDPD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |