C17H22N4O4 — CID 119357288
4-[3-(1H-indazole-3-carbonylamino)propanoylamino]-4-methylpentanoic acid (PubChem CID 119357288) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[3-(1H-indazole-3-carbonylamino)propanoylamino]-4-methylpentanoic acid.
| Compound Name | 4-[3-(1H-indazole-3-carbonylamino)propanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119357288 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-[3-(1H-indazole-3-carbonylamino)propanoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)CCNC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C17H22N4O4/c1-17(2,9-7-14(23)24)19-13(22)8-10-18-16(25)15-11-5-3-4-6-12(11)20-21-15/h3-6H,7-10H2,1-2H3,(H,18,25)(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | CIWKGAPYQRRJPJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |