C16H18F3NO3 — CID 119360146
(2S)-3-methyl-2-[[2-[3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]butanoic acid (PubChem CID 119360146) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[2-[3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[2-[3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119360146 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (2S)-3-methyl-2-[[2-[3-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]butanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C1CC1c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C16H18F3NO3/c1-8(2)13(15(22)23)20-14(21)12-7-11(12)9-4-3-5-10(6-9)16(17,18)19/h3-6,8,11-13H,7H2,1-2H3,(H,20,21)(H,22,23)/t11?,12?,13-/m0/s1 |
| InChIKey | VLNQZTYNJZRWAM-BPCQOVAHSA-N |
| XLogP | 3.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |