C17H21NO5 — CID 119360844
(2S)-2-[[3-(methoxymethyl)-1-benzofuran-2-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 119360844) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is (2S)-2-[[3-(methoxymethyl)-1-benzofuran-2-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[3-(methoxymethyl)-1-benzofuran-2-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119360844 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (2S)-2-[[3-(methoxymethyl)-1-benzofuran-2-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | COCc1c(C(=O)N[C@@H](CC(C)C)C(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C17H21NO5/c1-10(2)8-13(17(20)21)18-16(19)15-12(9-22-3)11-6-4-5-7-14(11)23-15/h4-7,10,13H,8-9H2,1-3H3,(H,18,19)(H,20,21)/t13-/m0/s1 |
| InChIKey | OHMDWBKDCJXWTC-ZDUSSCGKSA-N |
| XLogP | 2.81 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |