C19H31N3O5 — CID 119361187
(2S)-4-methyl-2-[[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]pentanoic acid (PubChem CID 119361187) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119361187 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (2S)-4-methyl-2-[[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CN1C(=O)NC2(CC(C)CC(C)(C)C2)C1=O)C(=O)O |
| InChI | InChI=1S/C19H31N3O5/c1-11(2)6-13(15(24)25)20-14(23)9-22-16(26)19(21-17(22)27)8-12(3)7-18(4,5)10-19/h11-13H,6-10H2,1-5H3,(H,20,23)(H,21,27)(H,24,25)/t12?,13-,19?/m0/s1 |
| InChIKey | HENYHFWDUFURNN-MLZJXEJWSA-N |
| XLogP | 1.74 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|