C15H25N3O3 — CID 119361432
(2S)-2-[(1-tert-butyl-5-methylpyrazole-4-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 119361432) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S)-2-[(1-tert-butyl-5-methylpyrazole-4-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(1-tert-butyl-5-methylpyrazole-4-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119361432 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (2S)-2-[(1-tert-butyl-5-methylpyrazole-4-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | Cc1c(C(=O)N[C@@H](CC(C)C)C(=O)O)cnn1C(C)(C)C |
| InChI | InChI=1S/C15H25N3O3/c1-9(2)7-12(14(20)21)17-13(19)11-8-16-18(10(11)3)15(4,5)6/h8-9,12H,7H2,1-6H3,(H,17,19)(H,20,21)/t12-/m0/s1 |
| InChIKey | WSNWMZQZLNMKBW-LBPRGKRZSA-N |
| XLogP | 2.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |