C18H26N2O5S — CID 119362379
3-[(1-ethylsulfonyl-4-phenylpiperidine-4-carbonyl)-methylamino]propanoic acid (PubChem CID 119362379) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is 3-[(1-ethylsulfonyl-4-phenylpiperidine-4-carbonyl)-methylamino]propanoic acid.
| Compound Name | 3-[(1-ethylsulfonyl-4-phenylpiperidine-4-carbonyl)-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119362379 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[(1-ethylsulfonyl-4-phenylpiperidine-4-carbonyl)-methylamino]propanoic acid |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)N(C)CCC(=O)O)(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O5S/c1-3-26(24,25)20-13-10-18(11-14-20,15-7-5-4-6-8-15)17(23)19(2)12-9-16(21)22/h4-8H,3,9-14H2,1-2H3,(H,21,22) |
| InChIKey | KTMIQLWYDNAMHR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |