About 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid
3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid (PubChem CID 119362416) has the molecular formula C15H17N3O5
and a molecular weight of 319.32 g/mol. Its IUPAC name is 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid |
| PubChem CID | 119362416 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N(C)CCC(=O)O)ccc21 |
| InChI | InChI=1S/C15H17N3O5/c1-3-18-11-5-4-9(8-10(11)16-13(21)15(18)23)14(22)17(2)7-6-12(19)20/h4-5,8H,3,6-7H2,1-2H3,(H,16,21)(H,19,20) |
| InChIKey | BGWRUAAAELGZAK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid?
The IUPAC name of 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid (CID 119362416) is 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid.
What is the SMILES notation for 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid?
The canonical SMILES for 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid is CCn1c(=O)c(=O)[nH]c2cc(C(=O)N(C)CCC(=O)O)ccc21.
What is the InChIKey of 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid?
The InChIKey is BGWRUAAAELGZAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O5/c1-3-18-11-5-4-9(8-10(11)16-13(21)15(18)23)14(22)17(2)7-6-12(19)20/h4-5,8H,3,6-7H2,1-2H3,(H,16,21)(H,19,20).
What are the key properties of 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid?
3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid has a molecular weight of 319.32 g/mol, XLogP of 0.26, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-methylamino]propanoic acid is sourced from PubChem (CID 119362416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).