C18H20N2O4S — CID 119362961
3-[[2-[(4-ethylbenzoyl)amino]thiophene-3-carbonyl]-methylamino]propanoic acid (PubChem CID 119362961) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-[[2-[(4-ethylbenzoyl)amino]thiophene-3-carbonyl]-methylamino]propanoic acid.
| Compound Name | 3-[[2-[(4-ethylbenzoyl)amino]thiophene-3-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119362961 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-[[2-[(4-ethylbenzoyl)amino]thiophene-3-carbonyl]-methylamino]propanoic acid |
| SMILES | CCc1ccc(C(=O)Nc2sccc2C(=O)N(C)CCC(=O)O)cc1 |
| InChI | InChI=1S/C18H20N2O4S/c1-3-12-4-6-13(7-5-12)16(23)19-17-14(9-11-25-17)18(24)20(2)10-8-15(21)22/h4-7,9,11H,3,8,10H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | DOQIPHNQZVFDHE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |