C13H25NO5S — CID 119363310
(2R)-4-methyl-2-[3-(2-methylpropylsulfonyl)propanoylamino]pentanoic acid (PubChem CID 119363310) has the molecular formula C13H25NO5S and a molecular weight of 307.41 g/mol. Its IUPAC name is (2R)-4-methyl-2-[3-(2-methylpropylsulfonyl)propanoylamino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[3-(2-methylpropylsulfonyl)propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 119363310 |
| Molecular Formula | C13H25NO5S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (2R)-4-methyl-2-[3-(2-methylpropylsulfonyl)propanoylamino]pentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)CCS(=O)(=O)CC(C)C)C(=O)O |
| InChI | InChI=1S/C13H25NO5S/c1-9(2)7-11(13(16)17)14-12(15)5-6-20(18,19)8-10(3)4/h9-11H,5-8H2,1-4H3,(H,14,15)(H,16,17)/t11-/m1/s1 |
| InChIKey | GZUJHBVNEJIAHS-LLVKDONJSA-N |
| XLogP | 1.06 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |