C17H25NO4 — CID 119364391
(2R)-4-methyl-2-[[2-(2-propan-2-yloxyphenyl)acetyl]amino]pentanoic acid (PubChem CID 119364391) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2R)-4-methyl-2-[[2-(2-propan-2-yloxyphenyl)acetyl]amino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[[2-(2-propan-2-yloxyphenyl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119364391 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (2R)-4-methyl-2-[[2-(2-propan-2-yloxyphenyl)acetyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)Cc1ccccc1OC(C)C)C(=O)O |
| InChI | InChI=1S/C17H25NO4/c1-11(2)9-14(17(20)21)18-16(19)10-13-7-5-6-8-15(13)22-12(3)4/h5-8,11-12,14H,9-10H2,1-4H3,(H,18,19)(H,20,21)/t14-/m1/s1 |
| InChIKey | IQMXWKMWDBUMLH-CQSZACIVSA-N |
| XLogP | 2.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |