C18H30N2O4 — CID 119364518
(2R)-4-methyl-2-[[1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid (PubChem CID 119364518) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2R)-4-methyl-2-[[1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid.
| Compound Name | (2R)-4-methyl-2-[[1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119364518 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (2R)-4-methyl-2-[[1-(4-methylcyclohexyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)C1CC(=O)N(C2CCC(C)CC2)C1)C(=O)O |
| InChI | InChI=1S/C18H30N2O4/c1-11(2)8-15(18(23)24)19-17(22)13-9-16(21)20(10-13)14-6-4-12(3)5-7-14/h11-15H,4-10H2,1-3H3,(H,19,22)(H,23,24)/t12?,13?,14?,15-/m1/s1 |
| InChIKey | NRXHSHWSYMWAPG-MLGYPOCJSA-N |
| XLogP | 2.03 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |