C18H21N3O4 — CID 119364680
(2R)-2-[(1-benzyl-6-oxopyridazine-3-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 119364680) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2R)-2-[(1-benzyl-6-oxopyridazine-3-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(1-benzyl-6-oxopyridazine-3-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119364680 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (2R)-2-[(1-benzyl-6-oxopyridazine-3-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)c1ccc(=O)n(Cc2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C18H21N3O4/c1-12(2)10-15(18(24)25)19-17(23)14-8-9-16(22)21(20-14)11-13-6-4-3-5-7-13/h3-9,12,15H,10-11H2,1-2H3,(H,19,23)(H,24,25)/t15-/m1/s1 |
| InChIKey | PKOMGKLZEOTNPI-OAHLLOKOSA-N |
| XLogP | 1.52 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |