C19H30N2O4 — CID 119365518
(2S)-1-[4-[(2-cyclopentylacetyl)amino]cyclohexanecarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 119365518) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2S)-1-[4-[(2-cyclopentylacetyl)amino]cyclohexanecarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[4-[(2-cyclopentylacetyl)amino]cyclohexanecarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119365518 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (2S)-1-[4-[(2-cyclopentylacetyl)amino]cyclohexanecarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(CC1CCCC1)NC1CCC(C(=O)N2CCC[C@H]2C(=O)O)CC1 |
| InChI | InChI=1S/C19H30N2O4/c22-17(12-13-4-1-2-5-13)20-15-9-7-14(8-10-15)18(23)21-11-3-6-16(21)19(24)25/h13-16H,1-12H2,(H,20,22)(H,24,25)/t14?,15?,16-/m0/s1 |
| InChIKey | UVTRWTBXMYPVLJ-GPANFISMSA-N |
| XLogP | 2.32 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |