C18H18N2O4 — CID 119365774
(2S)-1-[4-(pyridin-4-ylmethoxy)benzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119365774) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is (2S)-1-[4-(pyridin-4-ylmethoxy)benzoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[4-(pyridin-4-ylmethoxy)benzoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119365774 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2S)-1-[4-(pyridin-4-ylmethoxy)benzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)c1ccc(OCc2ccncc2)cc1 |
| InChI | InChI=1S/C18H18N2O4/c21-17(20-11-1-2-16(20)18(22)23)14-3-5-15(6-4-14)24-12-13-7-9-19-10-8-13/h3-10,16H,1-2,11-12H2,(H,22,23)/t16-/m0/s1 |
| InChIKey | KSFRGDDXVTXXFW-INIZCTEOSA-N |
| XLogP | 2.35 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |