C15H19N3O5 — CID 119367206
(2R)-2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 119367206) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is (2R)-2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 119367206 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2R)-2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(=O)NCC(=O)NCC(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H19N3O5/c1-10(19)16-8-13(20)17-9-14(21)18-12(15(22)23)7-11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3,(H,16,19)(H,17,20)(H,18,21)(H,22,23)/t12-/m1/s1 |
| InChIKey | JEASNJFOWZGOGI-GFCCVEGCSA-N |
| XLogP | -0.95 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |