C14H19N3O5S — CID 119367985
(2R)-2-phenyl-2-[(1-sulfamoylpiperidine-4-carbonyl)amino]acetic acid (PubChem CID 119367985) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[(1-sulfamoylpiperidine-4-carbonyl)amino]acetic acid.
| Compound Name | (2R)-2-phenyl-2-[(1-sulfamoylpiperidine-4-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 119367985 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (2R)-2-phenyl-2-[(1-sulfamoylpiperidine-4-carbonyl)amino]acetic acid |
| SMILES | NS(=O)(=O)N1CCC(C(=O)N[C@@H](C(=O)O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H19N3O5S/c15-23(21,22)17-8-6-11(7-9-17)13(18)16-12(14(19)20)10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,16,18)(H,19,20)(H2,15,21,22)/t12-/m1/s1 |
| InChIKey | CCVYXLLQACZWFB-GFCCVEGCSA-N |
| XLogP | -0.16 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |