C10H19NO4 — CID 119368911
(2R)-2-(2-methoxybutanoylamino)-3-methylbutanoic acid (PubChem CID 119368911) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is (2R)-2-(2-methoxybutanoylamino)-3-methylbutanoic acid.
| Compound Name | (2R)-2-(2-methoxybutanoylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 119368911 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (2R)-2-(2-methoxybutanoylamino)-3-methylbutanoic acid |
| SMILES | CCC(OC)C(=O)N[C@@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C10H19NO4/c1-5-7(15-4)9(12)11-8(6(2)3)10(13)14/h6-8H,5H2,1-4H3,(H,11,12)(H,13,14)/t7?,8-/m1/s1 |
| InChIKey | MGNMRMXNQLBWML-BRFYHDHCSA-N |
| XLogP | 0.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |