C12H13ClN2O6 — CID 119369892
(2R)-2-[2-(4-chloro-2-nitrophenoxy)propanoylamino]propanoic acid (PubChem CID 119369892) has the molecular formula C12H13ClN2O6 and a molecular weight of 316.70 g/mol. Its IUPAC name is (2R)-2-[2-(4-chloro-2-nitrophenoxy)propanoylamino]propanoic acid.
| Compound Name | (2R)-2-[2-(4-chloro-2-nitrophenoxy)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119369892 |
| Molecular Formula | C12H13ClN2O6 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | (2R)-2-[2-(4-chloro-2-nitrophenoxy)propanoylamino]propanoic acid |
| SMILES | CC(Oc1ccc(Cl)cc1[N+](=O)[O-])C(=O)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C12H13ClN2O6/c1-6(12(17)18)14-11(16)7(2)21-10-4-3-8(13)5-9(10)15(19)20/h3-7H,1-2H3,(H,14,16)(H,17,18)/t6-,7?/m1/s1 |
| InChIKey | HGDUVBDNLXYWHK-ULUSZKPHSA-N |
| XLogP | 1.60 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|