C9H10BrNO3S — CID 119370174
(2R)-2-[(2-bromo-5-methylthiophene-3-carbonyl)amino]propanoic acid (PubChem CID 119370174) has the molecular formula C9H10BrNO3S and a molecular weight of 292.15 g/mol. Its IUPAC name is (2R)-2-[(2-bromo-5-methylthiophene-3-carbonyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(2-bromo-5-methylthiophene-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119370174 |
| Molecular Formula | C9H10BrNO3S |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 290.96 |
| IUPAC Name | (2R)-2-[(2-bromo-5-methylthiophene-3-carbonyl)amino]propanoic acid |
| SMILES | Cc1cc(C(=O)N[C@H](C)C(=O)O)c(Br)s1 |
| InChI | InChI=1S/C9H10BrNO3S/c1-4-3-6(7(10)15-4)8(12)11-5(2)9(13)14/h3,5H,1-2H3,(H,11,12)(H,13,14)/t5-/m1/s1 |
| InChIKey | DMBDXPYZAIIKNP-RXMQYKEDSA-N |
| XLogP | 2.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |