C18H22N2O5 — CID 119371077
(2R)-1-[1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 119371077) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is (2R)-1-[1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119371077 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (2R)-1-[1-(2-ethoxyphenyl)-5-oxopyrrolidine-3-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOc1ccccc1N1CC(C(=O)N2CCC[C@@H]2C(=O)O)CC1=O |
| InChI | InChI=1S/C18H22N2O5/c1-2-25-15-8-4-3-6-13(15)20-11-12(10-16(20)21)17(22)19-9-5-7-14(19)18(23)24/h3-4,6,8,12,14H,2,5,7,9-11H2,1H3,(H,23,24)/t12?,14-/m1/s1 |
| InChIKey | HGCPZCFGHACLCV-TYZXPVIJSA-N |
| XLogP | 1.51 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |