C16H26N2O4 — CID 119371105
(2R)-1-[3-(cyclohexanecarbonylamino)butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119371105) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2R)-1-[3-(cyclohexanecarbonylamino)butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[3-(cyclohexanecarbonylamino)butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119371105 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (2R)-1-[3-(cyclohexanecarbonylamino)butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(CC(=O)N1CCC[C@@H]1C(=O)O)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C16H26N2O4/c1-11(17-15(20)12-6-3-2-4-7-12)10-14(19)18-9-5-8-13(18)16(21)22/h11-13H,2-10H2,1H3,(H,17,20)(H,21,22)/t11?,13-/m1/s1 |
| InChIKey | ZQBWJAPCRRZVFJ-GLGOKHISSA-N |
| XLogP | 1.54 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |