C13H19N3O5 — CID 119371588
(2R)-1-[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 119371588) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2R)-1-[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119371588 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (2R)-1-[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCN1CCN(CC(=O)N2CCC[C@@H]2C(=O)O)C(=O)C1=O |
| InChI | InChI=1S/C13H19N3O5/c1-2-14-6-7-15(12(19)11(14)18)8-10(17)16-5-3-4-9(16)13(20)21/h9H,2-8H2,1H3,(H,20,21)/t9-/m1/s1 |
| InChIKey | HAYBMDFLLVASJZ-SECBINFHSA-N |
| XLogP | -1.25 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|