C15H16Cl2N2O4 — CID 119372200
(2R)-1-[2-[(2,3-dichlorobenzoyl)amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119372200) has the molecular formula C15H16Cl2N2O4 and a molecular weight of 359.21 g/mol. Its IUPAC name is (2R)-1-[2-[(2,3-dichlorobenzoyl)amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-[(2,3-dichlorobenzoyl)amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119372200 |
| Molecular Formula | C15H16Cl2N2O4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | (2R)-1-[2-[(2,3-dichlorobenzoyl)amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(NC(=O)c1cccc(Cl)c1Cl)C(=O)N1CCC[C@@H]1C(=O)O |
| InChI | InChI=1S/C15H16Cl2N2O4/c1-8(14(21)19-7-3-6-11(19)15(22)23)18-13(20)9-4-2-5-10(16)12(9)17/h2,4-5,8,11H,3,6-7H2,1H3,(H,18,20)(H,22,23)/t8?,11-/m1/s1 |
| InChIKey | WIXHEERMBLWVBT-QHDYGNBISA-N |
| XLogP | 2.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |