C17H24N2O2S2 — CID 119373508
1-(4-aminopiperidin-1-yl)-2-[4-(1,3-dithian-2-yl)phenoxy]ethanone (PubChem CID 119373508) has the molecular formula C17H24N2O2S2 and a molecular weight of 352.53 g/mol. Its IUPAC name is 1-(4-aminopiperidin-1-yl)-2-[4-(1,3-dithian-2-yl)phenoxy]ethanone.
| Compound Name | 1-(4-aminopiperidin-1-yl)-2-[4-(1,3-dithian-2-yl)phenoxy]ethanone |
|---|---|
| PubChem CID | 119373508 |
| Molecular Formula | C17H24N2O2S2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-(4-aminopiperidin-1-yl)-2-[4-(1,3-dithian-2-yl)phenoxy]ethanone |
| SMILES | NC1CCN(C(=O)COc2ccc(C3SCCCS3)cc2)CC1 |
| InChI | InChI=1S/C17H24N2O2S2/c18-14-6-8-19(9-7-14)16(20)12-21-15-4-2-13(3-5-15)17-22-10-1-11-23-17/h2-5,14,17H,1,6-12,18H2 |
| InChIKey | NBJGLLLILNSIQI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |