C18H19ClFN3O2S — CID 119374606
N-[5-(4-aminopiperidine-1-carbonyl)-4-methylthiophen-2-yl]-2-chloro-4-fluorobenzamide (PubChem CID 119374606) has the molecular formula C18H19ClFN3O2S and a molecular weight of 395.89 g/mol. Its IUPAC name is N-[5-(4-aminopiperidine-1-carbonyl)-4-methylthiophen-2-yl]-2-chloro-4-fluorobenzamide.
| Compound Name | N-[5-(4-aminopiperidine-1-carbonyl)-4-methylthiophen-2-yl]-2-chloro-4-fluorobenzamide |
|---|---|
| PubChem CID | 119374606 |
| Molecular Formula | C18H19ClFN3O2S |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[5-(4-aminopiperidine-1-carbonyl)-4-methylthiophen-2-yl]-2-chloro-4-fluorobenzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(F)cc2Cl)sc1C(=O)N1CCC(N)CC1 |
| InChI | InChI=1S/C18H19ClFN3O2S/c1-10-8-15(22-17(24)13-3-2-11(20)9-14(13)19)26-16(10)18(25)23-6-4-12(21)5-7-23/h2-3,8-9,12H,4-7,21H2,1H3,(H,22,24) |
| InChIKey | BQCFJYYHUJUCRG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |