C15H19N5O — CID 119374753
(4-aminopiperidin-1-yl)-[1-(3-methylphenyl)triazol-4-yl]methanone (PubChem CID 119374753) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[1-(3-methylphenyl)triazol-4-yl]methanone.
| Compound Name | (4-aminopiperidin-1-yl)-[1-(3-methylphenyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 119374753 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[1-(3-methylphenyl)triazol-4-yl]methanone |
| SMILES | Cc1cccc(-n2cc(C(=O)N3CCC(N)CC3)nn2)c1 |
| InChI | InChI=1S/C15H19N5O/c1-11-3-2-4-13(9-11)20-10-14(17-18-20)15(21)19-7-5-12(16)6-8-19/h2-4,9-10,12H,5-8,16H2,1H3 |
| InChIKey | NOJSAYNYYSIPRN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |