C18H24F3N3O — CID 119375806
(4-aminopiperidin-1-yl)-[1-benzyl-3-(trifluoromethyl)pyrrolidin-3-yl]methanone (PubChem CID 119375806) has the molecular formula C18H24F3N3O and a molecular weight of 355.40 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[1-benzyl-3-(trifluoromethyl)pyrrolidin-3-yl]methanone.
| Compound Name | (4-aminopiperidin-1-yl)-[1-benzyl-3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 119375806 |
| Molecular Formula | C18H24F3N3O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[1-benzyl-3-(trifluoromethyl)pyrrolidin-3-yl]methanone |
| SMILES | NC1CCN(C(=O)C2(C(F)(F)F)CCN(Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C18H24F3N3O/c19-18(20,21)17(16(25)24-9-6-15(22)7-10-24)8-11-23(13-17)12-14-4-2-1-3-5-14/h1-5,15H,6-13,22H2 |
| InChIKey | BOTKMFDZPUYRAS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |