C20H31N4O5+ — CID 11937737
(2S)-6-azaniumyl-2-[[(2S)-1-[(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]hexanoate (PubChem CID 11937737) has the molecular formula C20H31N4O5+ and a molecular weight of 407.49 g/mol. Its IUPAC name is (2S)-6-azaniumyl-2-[[(2S)-1-[(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]hexanoate.
| Compound Name | (2S)-6-azaniumyl-2-[[(2S)-1-[(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 11937737 |
| Molecular Formula | C20H31N4O5+ |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (2S)-6-azaniumyl-2-[[(2S)-1-[(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]hexanoate |
| SMILES | [NH3+]CCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]([NH3+])Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C20H30N4O5/c21-10-2-1-4-16(20(28)29)23-18(26)17-5-3-11-24(17)19(27)15(22)12-13-6-8-14(25)9-7-13/h6-9,15-17,25H,1-5,10-12,21-22H2,(H,23,26)(H,28,29)/p+1/t15-,16-,17-/m0/s1 |
| InChIKey | MNWINJDPGBNOED-ULQDDVLXSA-O |
| XLogP | -2.82 |
| TPSA | 165.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|