C16H19F3N2O2 — CID 119377556
(3-aminopiperidin-1-yl)-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]methanone (PubChem CID 119377556) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]methanone.
| Compound Name | (3-aminopiperidin-1-yl)-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]methanone |
|---|---|
| PubChem CID | 119377556 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[2-[2-(trifluoromethoxy)phenyl]cyclopropyl]methanone |
| SMILES | NC1CCCN(C(=O)C2CC2c2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C16H19F3N2O2/c17-16(18,19)23-14-6-2-1-5-11(14)12-8-13(12)15(22)21-7-3-4-10(20)9-21/h1-2,5-6,10,12-13H,3-4,7-9,20H2 |
| InChIKey | AEZNKTABKLUMBU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |