C15H22ClFN2O2 — CID 119377861
1-(3-aminopiperidin-1-yl)-3-(3-fluoro-4-methoxyphenyl)propan-1-one;hydrochloride (PubChem CID 119377861) has the molecular formula C15H22ClFN2O2 and a molecular weight of 316.80 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)-3-(3-fluoro-4-methoxyphenyl)propan-1-one;hydrochloride.
| Compound Name | 1-(3-aminopiperidin-1-yl)-3-(3-fluoro-4-methoxyphenyl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119377861 |
| Molecular Formula | C15H22ClFN2O2 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)-3-(3-fluoro-4-methoxyphenyl)propan-1-one;hydrochloride |
| SMILES | COc1ccc(CCC(=O)N2CCCC(N)C2)cc1F.Cl |
| InChI | InChI=1S/C15H21FN2O2.ClH/c1-20-14-6-4-11(9-13(14)16)5-7-15(19)18-8-2-3-12(17)10-18;/h4,6,9,12H,2-3,5,7-8,10,17H2,1H3;1H |
| InChIKey | DBXARHSISYYZPZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |