C10H18Cl2N4O — CID 119380216
1-(3-aminopiperidin-1-yl)-2-pyrazol-1-ylethanone;dihydrochloride (PubChem CID 119380216) has the molecular formula C10H18Cl2N4O and a molecular weight of 281.19 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)-2-pyrazol-1-ylethanone;dihydrochloride.
| Compound Name | 1-(3-aminopiperidin-1-yl)-2-pyrazol-1-ylethanone;dihydrochloride |
|---|---|
| PubChem CID | 119380216 |
| Molecular Formula | C10H18Cl2N4O |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)-2-pyrazol-1-ylethanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCN(C(=O)Cn2cccn2)C1 |
| InChI | InChI=1S/C10H16N4O.2ClH/c11-9-3-1-5-13(7-9)10(15)8-14-6-2-4-12-14;;/h2,4,6,9H,1,3,5,7-8,11H2;2*1H |
| InChIKey | LCQOVWHUGZCEPJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |