C22H26N2O — CID 119381181
1-(3-aminopiperidin-1-yl)-4-(9H-fluoren-3-yl)butan-1-one (PubChem CID 119381181) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)-4-(9H-fluoren-3-yl)butan-1-one.
| Compound Name | 1-(3-aminopiperidin-1-yl)-4-(9H-fluoren-3-yl)butan-1-one |
|---|---|
| PubChem CID | 119381181 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)-4-(9H-fluoren-3-yl)butan-1-one |
| SMILES | NC1CCCN(C(=O)CCCc2ccc3c(c2)-c2ccccc2C3)C1 |
| InChI | InChI=1S/C22H26N2O/c23-19-7-4-12-24(15-19)22(25)9-3-5-16-10-11-18-14-17-6-1-2-8-20(17)21(18)13-16/h1-2,6,8,10-11,13,19H,3-5,7,9,12,14-15,23H2 |
| InChIKey | WXQDCVHIXNAGDT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |