C14H18ClF3N2O2 — CID 119381637
1-(3-aminopiperidin-1-yl)-2-[4-(trifluoromethoxy)phenyl]ethanone;hydrochloride (PubChem CID 119381637) has the molecular formula C14H18ClF3N2O2 and a molecular weight of 338.76 g/mol. Its IUPAC name is 1-(3-aminopiperidin-1-yl)-2-[4-(trifluoromethoxy)phenyl]ethanone;hydrochloride.
| Compound Name | 1-(3-aminopiperidin-1-yl)-2-[4-(trifluoromethoxy)phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119381637 |
| Molecular Formula | C14H18ClF3N2O2 |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(3-aminopiperidin-1-yl)-2-[4-(trifluoromethoxy)phenyl]ethanone;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)Cc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H17F3N2O2.ClH/c15-14(16,17)21-12-5-3-10(4-6-12)8-13(20)19-7-1-2-11(18)9-19;/h3-6,11H,1-2,7-9,18H2;1H |
| InChIKey | JNIPYXILQJQOER-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |