C11H19Cl2N3O2 — CID 119384241
N-(2-aminoethyl)-3-propan-2-yloxypyridine-2-carboxamide;dihydrochloride (PubChem CID 119384241) has the molecular formula C11H19Cl2N3O2 and a molecular weight of 296.20 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-propan-2-yloxypyridine-2-carboxamide;dihydrochloride.
| Compound Name | N-(2-aminoethyl)-3-propan-2-yloxypyridine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119384241 |
| Molecular Formula | C11H19Cl2N3O2 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-(2-aminoethyl)-3-propan-2-yloxypyridine-2-carboxamide;dihydrochloride |
| SMILES | CC(C)Oc1cccnc1C(=O)NCCN.Cl.Cl |
| InChI | InChI=1S/C11H17N3O2.2ClH/c1-8(2)16-9-4-3-6-13-10(9)11(15)14-7-5-12;;/h3-4,6,8H,5,7,12H2,1-2H3,(H,14,15);2*1H |
| InChIKey | BIGYNQDKCOBMJI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |