C15H19N5O2 — CID 119386440
3-(4-oxo-1,2,3-benzotriazin-3-yl)-N-piperidin-4-ylpropanamide (PubChem CID 119386440) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-(4-oxo-1,2,3-benzotriazin-3-yl)-N-piperidin-4-ylpropanamide.
| Compound Name | 3-(4-oxo-1,2,3-benzotriazin-3-yl)-N-piperidin-4-ylpropanamide |
|---|---|
| PubChem CID | 119386440 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3-(4-oxo-1,2,3-benzotriazin-3-yl)-N-piperidin-4-ylpropanamide |
| SMILES | O=C(CCn1nnc2ccccc2c1=O)NC1CCNCC1 |
| InChI | InChI=1S/C15H19N5O2/c21-14(17-11-5-8-16-9-6-11)7-10-20-15(22)12-3-1-2-4-13(12)18-19-20/h1-4,11,16H,5-10H2,(H,17,21) |
| InChIKey | KOOUNXVNEJVDMB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |