C18H17F2NO5S — CID 11938895
[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 2-[(S)-methylsulfinyl]benzoate (PubChem CID 11938895) has the molecular formula C18H17F2NO5S and a molecular weight of 397.40 g/mol. Its IUPAC name is [(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 2-[(S)-methylsulfinyl]benzoate.
| Compound Name | [(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 2-[(S)-methylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11938895 |
| Molecular Formula | C18H17F2NO5S |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl] 2-[(S)-methylsulfinyl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1[S@](C)=O)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H17F2NO5S/c1-11(25-17(23)12-7-3-6-10-15(12)27(2)24)16(22)21-13-8-4-5-9-14(13)26-18(19)20/h3-11,18H,1-2H3,(H,21,22)/t11-,27-/m0/s1 |
| InChIKey | GPGBSYSBYYNGAB-RNUGCUGFSA-N |
| XLogP | 3.21 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |