C17H28ClN3O3 — CID 119392200
4-ethoxy-3-methoxy-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride (PubChem CID 119392200) has the molecular formula C17H28ClN3O3 and a molecular weight of 357.88 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride.
| Compound Name | 4-ethoxy-3-methoxy-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119392200 |
| Molecular Formula | C17H28ClN3O3 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 4-ethoxy-3-methoxy-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
| SMILES | CCOc1ccc(C(=O)NCCCN2CCNCC2)cc1OC.Cl |
| InChI | InChI=1S/C17H27N3O3.ClH/c1-3-23-15-6-5-14(13-16(15)22-2)17(21)19-7-4-10-20-11-8-18-9-12-20;/h5-6,13,18H,3-4,7-12H2,1-2H3,(H,19,21);1H |
| InChIKey | VUJSQOQYKYNOBX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|