C20H33ClN4O3 — CID 119392270
4-methoxy-N-[3-methyl-1-oxo-1-(3-piperazin-1-ylpropylamino)butan-2-yl]benzamide;hydrochloride (PubChem CID 119392270) has the molecular formula C20H33ClN4O3 and a molecular weight of 412.96 g/mol. Its IUPAC name is 4-methoxy-N-[3-methyl-1-oxo-1-(3-piperazin-1-ylpropylamino)butan-2-yl]benzamide;hydrochloride.
| Compound Name | 4-methoxy-N-[3-methyl-1-oxo-1-(3-piperazin-1-ylpropylamino)butan-2-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119392270 |
| Molecular Formula | C20H33ClN4O3 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-methoxy-N-[3-methyl-1-oxo-1-(3-piperazin-1-ylpropylamino)butan-2-yl]benzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)NC(C(=O)NCCCN2CCNCC2)C(C)C)cc1.Cl |
| InChI | InChI=1S/C20H32N4O3.ClH/c1-15(2)18(23-19(25)16-5-7-17(27-3)8-6-16)20(26)22-9-4-12-24-13-10-21-11-14-24;/h5-8,15,18,21H,4,9-14H2,1-3H3,(H,22,26)(H,23,25);1H |
| InChIKey | AZEJBMWRUNMCQI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|