C18H28N6O2S — CID 119394611
1,3-dimethyl-N-[1-oxo-1-(3-piperazin-1-ylpropylamino)propan-2-yl]thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 119394611) has the molecular formula C18H28N6O2S and a molecular weight of 392.53 g/mol. Its IUPAC name is 1,3-dimethyl-N-[1-oxo-1-(3-piperazin-1-ylpropylamino)propan-2-yl]thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1,3-dimethyl-N-[1-oxo-1-(3-piperazin-1-ylpropylamino)propan-2-yl]thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 119394611 |
| Molecular Formula | C18H28N6O2S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 1,3-dimethyl-N-[1-oxo-1-(3-piperazin-1-ylpropylamino)propan-2-yl]thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c2sc(C(=O)NC(C)C(=O)NCCCN3CCNCC3)cc12 |
| InChI | InChI=1S/C18H28N6O2S/c1-12-14-11-15(27-18(14)23(3)22-12)17(26)21-13(2)16(25)20-5-4-8-24-9-6-19-7-10-24/h11,13,19H,4-10H2,1-3H3,(H,20,25)(H,21,26) |
| InChIKey | UDUSJADNLQWVNB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|