C20H25N3O — CID 119395281
(2-anilinophenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone (PubChem CID 119395281) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (2-anilinophenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone.
| Compound Name | (2-anilinophenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 119395281 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (2-anilinophenyl)-[3-(methylaminomethyl)piperidin-1-yl]methanone |
| SMILES | CNCC1CCCN(C(=O)c2ccccc2Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H25N3O/c1-21-14-16-8-7-13-23(15-16)20(24)18-11-5-6-12-19(18)22-17-9-3-2-4-10-17/h2-6,9-12,16,21-22H,7-8,13-15H2,1H3 |
| InChIKey | ONEOCSKXCOTVRP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |