C17H16ClFN2O2S — CID 1193965
2-[2-(4-chloro-2-methylanilino)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)acetamide (PubChem CID 1193965) has the molecular formula C17H16ClFN2O2S and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-[2-(4-chloro-2-methylanilino)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-(4-chloro-2-methylanilino)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 1193965 |
| Molecular Formula | C17H16ClFN2O2S |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[2-(4-chloro-2-methylanilino)-2-oxoethyl]sulfanyl-N-(4-fluorophenyl)acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CSCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16ClFN2O2S/c1-11-8-12(18)2-7-15(11)21-17(23)10-24-9-16(22)20-14-5-3-13(19)4-6-14/h2-8H,9-10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | DEXGYWAQMKKJQJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |