C17H22ClN3O2 — CID 119396572
3-[3-(methylaminomethyl)piperidine-1-carbonyl]-1H-quinolin-2-one;hydrochloride (PubChem CID 119396572) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 3-[3-(methylaminomethyl)piperidine-1-carbonyl]-1H-quinolin-2-one;hydrochloride.
| Compound Name | 3-[3-(methylaminomethyl)piperidine-1-carbonyl]-1H-quinolin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119396572 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-[3-(methylaminomethyl)piperidine-1-carbonyl]-1H-quinolin-2-one;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)c2cc3ccccc3[nH]c2=O)C1.Cl |
| InChI | InChI=1S/C17H21N3O2.ClH/c1-18-10-12-5-4-8-20(11-12)17(22)14-9-13-6-2-3-7-15(13)19-16(14)21;/h2-3,6-7,9,12,18H,4-5,8,10-11H2,1H3,(H,19,21);1H |
| InChIKey | XJMHMAKMILWMIS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |