C23H27FN4O3S — CID 11939741
(3aS,4R,5R,7R,7aR)-2-[4-(dimethylamino)phenyl]imino-3-[(4-fluorophenyl)methyl]-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 11939741) has the molecular formula C23H27FN4O3S and a molecular weight of 458.56 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-2-[4-(dimethylamino)phenyl]imino-3-[(4-fluorophenyl)methyl]-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-2-[4-(dimethylamino)phenyl]imino-3-[(4-fluorophenyl)methyl]-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 11939741 |
| Molecular Formula | C23H27FN4O3S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-2-[4-(dimethylamino)phenyl]imino-3-[(4-fluorophenyl)methyl]-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | CN(C)c1ccc(/N=C2\S[C@H]3[C@H]([C@@H](O)[C@H](O)C[C@@H]3C(N)=O)N2Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H27FN4O3S/c1-27(2)16-9-7-15(8-10-16)26-23-28(12-13-3-5-14(24)6-4-13)19-20(30)18(29)11-17(22(25)31)21(19)32-23/h3-10,17-21,29-30H,11-12H2,1-2H3,(H2,25,31)/b26-23-/t17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | PEEYVEOLLPKCQY-YDJBGMTKSA-N |
| XLogP | 2.09 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|